C21H38O7 — CID 51694025
(2R,3R,4R,5S,6S)-2-[(2R)-2-[(1R,2S,3R)-3-hydroxy-2,3-dimethylcyclopentyl]-6-methylhept-5-en-2-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 51694025) has the molecular formula C21H38O7 and a molecular weight of 402.53 g/mol. Its IUPAC name is (2R,3R,4R,5S,6S)-2-[(2R)-2-[(1R,2S,3R)-3-hydroxy-2,3-dimethylcyclopentyl]-6-methylhept-5-en-2-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2R,3R,4R,5S,6S)-2-[(2R)-2-[(1R,2S,3R)-3-hydroxy-2,3-dimethylcyclopentyl]-6-methylhept-5-en-2-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 51694025 |
| Molecular Formula | C21H38O7 |
| Molecular Weight | 402.53 g/mol |
| Exact Mass | 402.26 |
| IUPAC Name | (2R,3R,4R,5S,6S)-2-[(2R)-2-[(1R,2S,3R)-3-hydroxy-2,3-dimethylcyclopentyl]-6-methylhept-5-en-2-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CC(C)=CCC[C@@](C)(O[C@H]1O[C@@H](CO)[C@@H](O)[C@@H](O)[C@H]1O)[C@@H]1CC[C@@](C)(O)[C@H]1C |
| InChI | InChI=1S/C21H38O7/c1-12(2)7-6-9-21(5,14-8-10-20(4,26)13(14)3)28-19-18(25)17(24)16(23)15(11-22)27-19/h7,13-19,22-26H,6,8-11H2,1-5H3/t13-,14+,15-,16+,17+,18+,19+,20+,21+/m0/s1 |
| InChIKey | LBGHZRDBTXIUKX-FTUSIEGKSA-N |
| XLogP | 1.11 |
| TPSA | 119.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.53 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|