C17H16O5 — CID 51694127
(4R)-7,12-dihydroxy-4,5,5,14-tetramethyl-3,10-dioxatetracyclo[6.6.1.02,6.011,15]pentadeca-1(15),2(6),7,11,13-pentaen-9-one (PubChem CID 51694127) has the molecular formula C17H16O5 and a molecular weight of 300.31 g/mol. Its IUPAC name is (4R)-7,12-dihydroxy-4,5,5,14-tetramethyl-3,10-dioxatetracyclo[6.6.1.02,6.011,15]pentadeca-1(15),2(6),7,11,13-pentaen-9-one.
| Compound Name | (4R)-7,12-dihydroxy-4,5,5,14-tetramethyl-3,10-dioxatetracyclo[6.6.1.02,6.011,15]pentadeca-1(15),2(6),7,11,13-pentaen-9-one |
|---|---|
| PubChem CID | 51694127 |
| Molecular Formula | C17H16O5 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | (4R)-7,12-dihydroxy-4,5,5,14-tetramethyl-3,10-dioxatetracyclo[6.6.1.02,6.011,15]pentadeca-1(15),2(6),7,11,13-pentaen-9-one |
| SMILES | Cc1cc(O)c2c3c(c(O)c4c(c13)O[C@H](C)C4(C)C)C(=O)O2 |
| InChI | InChI=1S/C17H16O5/c1-6-5-8(18)14-10-9(6)15-12(17(3,4)7(2)21-15)13(19)11(10)16(20)22-14/h5,7,18-19H,1-4H3/t7-/m1/s1 |
| InChIKey | ZEQQGKYQWBIUCT-SSDOTTSWSA-N |
| XLogP | 3.15 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|