About 1-[(5R)-3-ethyl-4,5-dihydro-1,2-oxazol-5-yl]-N-methylmethanamine
1-[(5R)-3-ethyl-4,5-dihydro-1,2-oxazol-5-yl]-N-methylmethanamine (PubChem CID 51698766) has the molecular formula C7H14N2O
and a molecular weight of 142.20 g/mol. Its IUPAC name is 1-[(5R)-3-ethyl-4,5-dihydro-1,2-oxazol-5-yl]-N-methylmethanamine.
Molecular Properties
| Compound Name | 1-[(5R)-3-ethyl-4,5-dihydro-1,2-oxazol-5-yl]-N-methylmethanamine |
| PubChem CID | 51698766 |
| Molecular Formula | C7H14N2O |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.11 |
| IUPAC Name | 1-[(5R)-3-ethyl-4,5-dihydro-1,2-oxazol-5-yl]-N-methylmethanamine |
| SMILES | CCC1=NO[C@@H](CNC)C1 |
| InChI | InChI=1S/C7H14N2O/c1-3-6-4-7(5-8-2)10-9-6/h7-8H,3-5H2,1-2H3/t7-/m1/s1 |
| InChIKey | ZMITXKSKRXRCSG-SSDOTTSWSA-N |
| XLogP | 0.76 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[(5R)-3-ethyl-4,5-dihydro-1,2-oxazol-5-yl]-N-methylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(5R)-3-ethyl-4,5-dihydro-1,2-oxazol-5-yl]-N-methylmethanamine?
The IUPAC name of 1-[(5R)-3-ethyl-4,5-dihydro-1,2-oxazol-5-yl]-N-methylmethanamine (CID 51698766) is 1-[(5R)-3-ethyl-4,5-dihydro-1,2-oxazol-5-yl]-N-methylmethanamine.
What is the SMILES notation for 1-[(5R)-3-ethyl-4,5-dihydro-1,2-oxazol-5-yl]-N-methylmethanamine?
The canonical SMILES for 1-[(5R)-3-ethyl-4,5-dihydro-1,2-oxazol-5-yl]-N-methylmethanamine is CCC1=NO[C@@H](CNC)C1.
What is the InChIKey of 1-[(5R)-3-ethyl-4,5-dihydro-1,2-oxazol-5-yl]-N-methylmethanamine?
The InChIKey is ZMITXKSKRXRCSG-SSDOTTSWSA-N. The full InChI is InChI=1S/C7H14N2O/c1-3-6-4-7(5-8-2)10-9-6/h7-8H,3-5H2,1-2H3/t7-/m1/s1.
What are the key properties of 1-[(5R)-3-ethyl-4,5-dihydro-1,2-oxazol-5-yl]-N-methylmethanamine?
1-[(5R)-3-ethyl-4,5-dihydro-1,2-oxazol-5-yl]-N-methylmethanamine has a molecular weight of 142.20 g/mol, XLogP of 0.76, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(5R)-3-ethyl-4,5-dihydro-1,2-oxazol-5-yl]-N-methylmethanamine is sourced from PubChem (CID 51698766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).