C13H15F2N3O2S — CID 51699026
N-(2,5-difluorophenyl)-1-ethyl-3,5-dimethylpyrazole-4-sulfonamide (PubChem CID 51699026) has the molecular formula C13H15F2N3O2S and a molecular weight of 315.35 g/mol. Its IUPAC name is N-(2,5-difluorophenyl)-1-ethyl-3,5-dimethylpyrazole-4-sulfonamide.
| Compound Name | N-(2,5-difluorophenyl)-1-ethyl-3,5-dimethylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 51699026 |
| Molecular Formula | C13H15F2N3O2S |
| Molecular Weight | 315.35 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | N-(2,5-difluorophenyl)-1-ethyl-3,5-dimethylpyrazole-4-sulfonamide |
| SMILES | CCn1nc(C)c(S(=O)(=O)Nc2cc(F)ccc2F)c1C |
| InChI | InChI=1S/C13H15F2N3O2S/c1-4-18-9(3)13(8(2)16-18)21(19,20)17-12-7-10(14)5-6-11(12)15/h5-7,17H,4H2,1-3H3 |
| InChIKey | RNZHMWYNMTXLRG-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.35 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |