C22H27N7O3 — CID 51699954
4-N-(3,4-dimethylphenyl)-2-N-[(2S)-2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]-5-nitropyrimidine-2,4,6-triamine (PubChem CID 51699954) has the molecular formula C22H27N7O3 and a molecular weight of 437.50 g/mol. Its IUPAC name is 4-N-(3,4-dimethylphenyl)-2-N-[(2S)-2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]-5-nitropyrimidine-2,4,6-triamine.
| Compound Name | 4-N-(3,4-dimethylphenyl)-2-N-[(2S)-2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]-5-nitropyrimidine-2,4,6-triamine |
|---|---|
| PubChem CID | 51699954 |
| Molecular Formula | C22H27N7O3 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.22 |
| IUPAC Name | 4-N-(3,4-dimethylphenyl)-2-N-[(2S)-2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]-5-nitropyrimidine-2,4,6-triamine |
| SMILES | Cc1ccc(Nc2nc(NC[C@@H](c3ccco3)N3CCCC3)nc(N)c2[N+](=O)[O-])cc1C |
| InChI | InChI=1S/C22H27N7O3/c1-14-7-8-16(12-15(14)2)25-21-19(29(30)31)20(23)26-22(27-21)24-13-17(18-6-5-11-32-18)28-9-3-4-10-28/h5-8,11-12,17H,3-4,9-10,13H2,1-2H3,(H4,23,24,25,26,27)/t17-/m0/s1 |
| InChIKey | KSAUFYKQKKGSNQ-KRWDZBQOSA-N |
| XLogP | 4.17 |
| TPSA | 135.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|