About magnesium bis(quinolin-8-olate)
magnesium bis(quinolin-8-olate) (PubChem CID 517006) has the molecular formula C18H12MgN2O2
and a molecular weight of 312.61 g/mol. Its IUPAC name is magnesium bis(quinolin-8-olate).
Molecular Properties
| Compound Name | magnesium bis(quinolin-8-olate) |
| PubChem CID | 517006 |
| Molecular Formula | C18H12MgN2O2 |
| Molecular Weight | 312.61 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | magnesium bis(quinolin-8-olate) |
| SMILES | [Mg+2].[O-]c1cccc2cccnc12.[O-]c1cccc2cccnc12 |
| InChI | InChI=1S/2C9H7NO.Mg/c2*11-8-5-1-3-7-4-2-6-10-9(7)8;/h2*1-6,11H;/q;;+2/p-2 |
| InChIKey | PRGAWFXXABCMIW-UHFFFAOYSA-L |
| XLogP | 2.24 |
| TPSA | 71.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.61 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze magnesium bis(quinolin-8-olate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium bis(quinolin-8-olate)?
The IUPAC name of magnesium bis(quinolin-8-olate) (CID 517006) is magnesium bis(quinolin-8-olate).
What is the SMILES notation for magnesium bis(quinolin-8-olate)?
The canonical SMILES for magnesium bis(quinolin-8-olate) is [Mg+2].[O-]c1cccc2cccnc12.[O-]c1cccc2cccnc12.
What is the InChIKey of magnesium bis(quinolin-8-olate)?
The InChIKey is PRGAWFXXABCMIW-UHFFFAOYSA-L. The full InChI is InChI=1S/2C9H7NO.Mg/c2*11-8-5-1-3-7-4-2-6-10-9(7)8;/h2*1-6,11H;/q;;+2/p-2.
What are the key properties of magnesium bis(quinolin-8-olate)?
magnesium bis(quinolin-8-olate) has a molecular weight of 312.61 g/mol, XLogP of 2.24, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium bis(quinolin-8-olate) is sourced from PubChem (CID 517006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).