C9H7BrN2OS — CID 51700671
(6R)-6-bromo-10-thia-1,8-diazatricyclo[7.3.0.03,7]dodeca-3(7),8,11-trien-2-one (PubChem CID 51700671) has the molecular formula C9H7BrN2OS and a molecular weight of 271.14 g/mol. Its IUPAC name is (6R)-6-bromo-10-thia-1,8-diazatricyclo[7.3.0.03,7]dodeca-3(7),8,11-trien-2-one.
| Compound Name | (6R)-6-bromo-10-thia-1,8-diazatricyclo[7.3.0.03,7]dodeca-3(7),8,11-trien-2-one |
|---|---|
| PubChem CID | 51700671 |
| Molecular Formula | C9H7BrN2OS |
| Molecular Weight | 271.14 g/mol |
| Exact Mass | 269.95 |
| IUPAC Name | (6R)-6-bromo-10-thia-1,8-diazatricyclo[7.3.0.03,7]dodeca-3(7),8,11-trien-2-one |
| SMILES | O=c1c2c(nc3sccn13)[C@H](Br)CC2 |
| InChI | InChI=1S/C9H7BrN2OS/c10-6-2-1-5-7(6)11-9-12(8(5)13)3-4-14-9/h3-4,6H,1-2H2/t6-/m1/s1 |
| InChIKey | QMLUNEGJMYEDAO-ZCFIWIBFSA-N |
| XLogP | 2.14 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.14 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|