C19H19BrN4O2 — CID 51701480
2-bromo-N-[5-[(2R)-butan-2-yl]-2-hydroxyphenyl]-5-(1,2,4-triazol-4-yl)benzamide (PubChem CID 51701480) has the molecular formula C19H19BrN4O2 and a molecular weight of 415.29 g/mol. Its IUPAC name is 2-bromo-N-[5-[(2R)-butan-2-yl]-2-hydroxyphenyl]-5-(1,2,4-triazol-4-yl)benzamide.
| Compound Name | 2-bromo-N-[5-[(2R)-butan-2-yl]-2-hydroxyphenyl]-5-(1,2,4-triazol-4-yl)benzamide |
|---|---|
| PubChem CID | 51701480 |
| Molecular Formula | C19H19BrN4O2 |
| Molecular Weight | 415.29 g/mol |
| Exact Mass | 414.07 |
| IUPAC Name | 2-bromo-N-[5-[(2R)-butan-2-yl]-2-hydroxyphenyl]-5-(1,2,4-triazol-4-yl)benzamide |
| SMILES | CC[C@@H](C)c1ccc(O)c(NC(=O)c2cc(-n3cnnc3)ccc2Br)c1 |
| InChI | InChI=1S/C19H19BrN4O2/c1-3-12(2)13-4-7-18(25)17(8-13)23-19(26)15-9-14(5-6-16(15)20)24-10-21-22-11-24/h4-12,25H,3H2,1-2H3,(H,23,26)/t12-/m1/s1 |
| InChIKey | HQQDIOUSUXKWPY-GFCCVEGCSA-N |
| XLogP | 4.50 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.29 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|