C24H29N3O4 — CID 51703492
7-[(2R)-2-hydroxy-3-(4-pyridin-2-ylpiperazin-1-yl)propoxy]-3,4,8-trimethylchromen-2-one (PubChem CID 51703492) has the molecular formula C24H29N3O4 and a molecular weight of 423.51 g/mol. Its IUPAC name is 7-[(2R)-2-hydroxy-3-(4-pyridin-2-ylpiperazin-1-yl)propoxy]-3,4,8-trimethylchromen-2-one.
| Compound Name | 7-[(2R)-2-hydroxy-3-(4-pyridin-2-ylpiperazin-1-yl)propoxy]-3,4,8-trimethylchromen-2-one |
|---|---|
| PubChem CID | 51703492 |
| Molecular Formula | C24H29N3O4 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.22 |
| IUPAC Name | 7-[(2R)-2-hydroxy-3-(4-pyridin-2-ylpiperazin-1-yl)propoxy]-3,4,8-trimethylchromen-2-one |
| SMILES | Cc1c(C)c2ccc(OC[C@H](O)CN3CCN(c4ccccn4)CC3)c(C)c2oc1=O |
| InChI | InChI=1S/C24H29N3O4/c1-16-17(2)24(29)31-23-18(3)21(8-7-20(16)23)30-15-19(28)14-26-10-12-27(13-11-26)22-6-4-5-9-25-22/h4-9,19,28H,10-15H2,1-3H3/t19-/m1/s1 |
| InChIKey | IIEQLWBXXMHXSA-LJQANCHMSA-N |
| XLogP | 2.68 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|