About ethyl 4-[(2R)-2-[(4,7-dimethoxy-1H-indole-2-carbonyl)amino]propanoyl]piperazine-1-carboxylate
ethyl 4-[(2R)-2-[(4,7-dimethoxy-1H-indole-2-carbonyl)amino]propanoyl]piperazine-1-carboxylate (PubChem CID 51703539) has the molecular formula C21H28N4O6
and a molecular weight of 432.48 g/mol. Its IUPAC name is ethyl 4-[(2R)-2-[(4,7-dimethoxy-1H-indole-2-carbonyl)amino]propanoyl]piperazine-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-[(2R)-2-[(4,7-dimethoxy-1H-indole-2-carbonyl)amino]propanoyl]piperazine-1-carboxylate |
| PubChem CID | 51703539 |
| Molecular Formula | C21H28N4O6 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | ethyl 4-[(2R)-2-[(4,7-dimethoxy-1H-indole-2-carbonyl)amino]propanoyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)[C@@H](C)NC(=O)c2cc3c(OC)ccc(OC)c3[nH]2)CC1 |
| InChI | InChI=1S/C21H28N4O6/c1-5-31-21(28)25-10-8-24(9-11-25)20(27)13(2)22-19(26)15-12-14-16(29-3)6-7-17(30-4)18(14)23-15/h6-7,12-13,23H,5,8-11H2,1-4H3,(H,22,26)/t13-/m1/s1 |
| InChIKey | AAVRXAQNMVGOQU-CYBMUJFWSA-N |
| XLogP | 1.60 |
| TPSA | 113.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 4-[(2R)-2-[(4,7-dimethoxy-1H-indole-2-carbonyl)amino]propanoyl]piperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[(2R)-2-[(4,7-dimethoxy-1H-indole-2-carbonyl)amino]propanoyl]piperazine-1-carboxylate?
The IUPAC name of ethyl 4-[(2R)-2-[(4,7-dimethoxy-1H-indole-2-carbonyl)amino]propanoyl]piperazine-1-carboxylate (CID 51703539) is ethyl 4-[(2R)-2-[(4,7-dimethoxy-1H-indole-2-carbonyl)amino]propanoyl]piperazine-1-carboxylate.
What is the SMILES notation for ethyl 4-[(2R)-2-[(4,7-dimethoxy-1H-indole-2-carbonyl)amino]propanoyl]piperazine-1-carboxylate?
The canonical SMILES for ethyl 4-[(2R)-2-[(4,7-dimethoxy-1H-indole-2-carbonyl)amino]propanoyl]piperazine-1-carboxylate is CCOC(=O)N1CCN(C(=O)[C@@H](C)NC(=O)c2cc3c(OC)ccc(OC)c3[nH]2)CC1.
What is the InChIKey of ethyl 4-[(2R)-2-[(4,7-dimethoxy-1H-indole-2-carbonyl)amino]propanoyl]piperazine-1-carboxylate?
The InChIKey is AAVRXAQNMVGOQU-CYBMUJFWSA-N. The full InChI is InChI=1S/C21H28N4O6/c1-5-31-21(28)25-10-8-24(9-11-25)20(27)13(2)22-19(26)15-12-14-16(29-3)6-7-17(30-4)18(14)23-15/h6-7,12-13,23H,5,8-11H2,1-4H3,(H,22,26)/t13-/m1/s1.
What are the key properties of ethyl 4-[(2R)-2-[(4,7-dimethoxy-1H-indole-2-carbonyl)amino]propanoyl]piperazine-1-carboxylate?
ethyl 4-[(2R)-2-[(4,7-dimethoxy-1H-indole-2-carbonyl)amino]propanoyl]piperazine-1-carboxylate has a molecular weight of 432.48 g/mol, XLogP of 1.60, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[(2R)-2-[(4,7-dimethoxy-1H-indole-2-carbonyl)amino]propanoyl]piperazine-1-carboxylate is sourced from PubChem (CID 51703539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).