C13H16N2O2 — CID 51704130
(2R)-3-(5,6-dimethylbenzimidazol-1-yl)-2-methylpropanoic acid (PubChem CID 51704130) has the molecular formula C13H16N2O2 and a molecular weight of 232.28 g/mol. Its IUPAC name is (2R)-3-(5,6-dimethylbenzimidazol-1-yl)-2-methylpropanoic acid.
| Compound Name | (2R)-3-(5,6-dimethylbenzimidazol-1-yl)-2-methylpropanoic acid |
|---|---|
| PubChem CID | 51704130 |
| Molecular Formula | C13H16N2O2 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | (2R)-3-(5,6-dimethylbenzimidazol-1-yl)-2-methylpropanoic acid |
| SMILES | Cc1cc2ncn(C[C@@H](C)C(=O)O)c2cc1C |
| InChI | InChI=1S/C13H16N2O2/c1-8-4-11-12(5-9(8)2)15(7-14-11)6-10(3)13(16)17/h4-5,7,10H,6H2,1-3H3,(H,16,17)/t10-/m1/s1 |
| InChIKey | MMEILEAEOHKIIF-SNVBAGLBSA-N |
| XLogP | 2.37 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |