(2R)-3-(5,6-dimethylbenzimidazol-1-yl)-2-methylpropanoic acid

C13H16N2O2 — CID 51704130

IUPAC(2R)-3-(5,6-dimethylbenzimidazol-1-yl)-2-methylpropanoic acid
SMILESCc1cc2ncn(C[C@@H](C)C(=O)O)c2cc1C
InChIInChI=1S/C13H16N2O2/c1-8-4-11-12(5-9(8)2)15(7-14-11)6-10(3)13(16)17/h4-5,7,10H,6H2,1-3H3,(H,16,17)/t10-/m1/s1
InChIKeyMMEILEAEOHKIIF-SNVBAGLBSA-N
MW232.28 g/mol
LogP2.37
Rot. Bonds3

About (2R)-3-(5,6-dimethylbenzimidazol-1-yl)-2-methylpropanoic acid

(2R)-3-(5,6-dimethylbenzimidazol-1-yl)-2-methylpropanoic acid (PubChem CID 51704130) has the molecular formula C13H16N2O2 and a molecular weight of 232.28 g/mol. Its IUPAC name is (2R)-3-(5,6-dimethylbenzimidazol-1-yl)-2-methylpropanoic acid.

Molecular Properties

Compound Name(2R)-3-(5,6-dimethylbenzimidazol-1-yl)-2-methylpropanoic acid
PubChem CID51704130
Molecular FormulaC13H16N2O2
Molecular Weight232.28 g/mol
Exact Mass232.12
IUPAC Name(2R)-3-(5,6-dimethylbenzimidazol-1-yl)-2-methylpropanoic acid
SMILESCc1cc2ncn(C[C@@H](C)C(=O)O)c2cc1C
InChIInChI=1S/C13H16N2O2/c1-8-4-11-12(5-9(8)2)15(7-14-11)6-10(3)13(16)17/h4-5,7,10H,6H2,1-3H3,(H,16,17)/t10-/m1/s1
InChIKeyMMEILEAEOHKIIF-SNVBAGLBSA-N
XLogP2.37
TPSA55.12 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500232.28
LogP ≤ 52.37
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze (2R)-3-(5,6-dimethylbenzimidazol-1-yl)-2-methylpropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2R)-3-(5,6-dimethylbenzimidazol-1-yl)-2-methylpropanoic acid?
The IUPAC name of (2R)-3-(5,6-dimethylbenzimidazol-1-yl)-2-methylpropanoic acid (CID 51704130) is (2R)-3-(5,6-dimethylbenzimidazol-1-yl)-2-methylpropanoic acid.
What is the SMILES notation for (2R)-3-(5,6-dimethylbenzimidazol-1-yl)-2-methylpropanoic acid?
The canonical SMILES for (2R)-3-(5,6-dimethylbenzimidazol-1-yl)-2-methylpropanoic acid is Cc1cc2ncn(C[C@@H](C)C(=O)O)c2cc1C.
What is the InChIKey of (2R)-3-(5,6-dimethylbenzimidazol-1-yl)-2-methylpropanoic acid?
The InChIKey is MMEILEAEOHKIIF-SNVBAGLBSA-N. The full InChI is InChI=1S/C13H16N2O2/c1-8-4-11-12(5-9(8)2)15(7-14-11)6-10(3)13(16)17/h4-5,7,10H,6H2,1-3H3,(H,16,17)/t10-/m1/s1.
What are the key properties of (2R)-3-(5,6-dimethylbenzimidazol-1-yl)-2-methylpropanoic acid?
(2R)-3-(5,6-dimethylbenzimidazol-1-yl)-2-methylpropanoic acid has a molecular weight of 232.28 g/mol, XLogP of 2.37, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-3-(5,6-dimethylbenzimidazol-1-yl)-2-methylpropanoic acid is sourced from PubChem (CID 51704130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).