C26H26ClNO7 — CID 51706558
6-O-methyl 3-O-propyl (4R,6R,7R)-4-(6-chloro-4-oxochromen-3-yl)-2,7-dimethyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate (PubChem CID 51706558) has the molecular formula C26H26ClNO7 and a molecular weight of 499.95 g/mol. Its IUPAC name is 6-O-methyl 3-O-propyl (4R,6R,7R)-4-(6-chloro-4-oxochromen-3-yl)-2,7-dimethyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate.
| Compound Name | 6-O-methyl 3-O-propyl (4R,6R,7R)-4-(6-chloro-4-oxochromen-3-yl)-2,7-dimethyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate |
|---|---|
| PubChem CID | 51706558 |
| Molecular Formula | C26H26ClNO7 |
| Molecular Weight | 499.95 g/mol |
| Exact Mass | 499.14 |
| IUPAC Name | 6-O-methyl 3-O-propyl (4R,6R,7R)-4-(6-chloro-4-oxochromen-3-yl)-2,7-dimethyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate |
| SMILES | CCCOC(=O)C1=C(C)NC2=C(C(=O)[C@H](C(=O)OC)[C@H](C)C2)[C@@H]1c1coc2ccc(Cl)cc2c1=O |
| InChI | InChI=1S/C26H26ClNO7/c1-5-8-34-26(32)20-13(3)28-17-9-12(2)19(25(31)33-4)24(30)22(17)21(20)16-11-35-18-7-6-14(27)10-15(18)23(16)29/h6-7,10-12,19,21,28H,5,8-9H2,1-4H3/t12-,19-,21-/m1/s1 |
| InChIKey | OOIRTAPAFWUPGL-PCFDJQJPSA-N |
| XLogP | 4.01 |
| TPSA | 111.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.95 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|