About 2-(1,3-benzodioxol-5-yl)-3-bromoimidazo[1,2-a]pyrimidine
2-(1,3-benzodioxol-5-yl)-3-bromoimidazo[1,2-a]pyrimidine (PubChem CID 5170670) has the molecular formula C13H8BrN3O2
and a molecular weight of 318.13 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-3-bromoimidazo[1,2-a]pyrimidine.
Molecular Properties
| Compound Name | 2-(1,3-benzodioxol-5-yl)-3-bromoimidazo[1,2-a]pyrimidine |
| PubChem CID | 5170670 |
| Molecular Formula | C13H8BrN3O2 |
| Molecular Weight | 318.13 g/mol |
| Exact Mass | 316.98 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-3-bromoimidazo[1,2-a]pyrimidine |
| SMILES | Brc1c(-c2ccc3c(c2)OCO3)nc2ncccn12 |
| InChI | InChI=1S/C13H8BrN3O2/c14-12-11(16-13-15-4-1-5-17(12)13)8-2-3-9-10(6-8)19-7-18-9/h1-6H,7H2 |
| InChIKey | KPKOQVHYBPOHMC-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 48.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.13 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(1,3-benzodioxol-5-yl)-3-bromoimidazo[1,2-a]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-benzodioxol-5-yl)-3-bromoimidazo[1,2-a]pyrimidine?
The IUPAC name of 2-(1,3-benzodioxol-5-yl)-3-bromoimidazo[1,2-a]pyrimidine (CID 5170670) is 2-(1,3-benzodioxol-5-yl)-3-bromoimidazo[1,2-a]pyrimidine.
What is the SMILES notation for 2-(1,3-benzodioxol-5-yl)-3-bromoimidazo[1,2-a]pyrimidine?
The canonical SMILES for 2-(1,3-benzodioxol-5-yl)-3-bromoimidazo[1,2-a]pyrimidine is Brc1c(-c2ccc3c(c2)OCO3)nc2ncccn12.
What is the InChIKey of 2-(1,3-benzodioxol-5-yl)-3-bromoimidazo[1,2-a]pyrimidine?
The InChIKey is KPKOQVHYBPOHMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8BrN3O2/c14-12-11(16-13-15-4-1-5-17(12)13)8-2-3-9-10(6-8)19-7-18-9/h1-6H,7H2.
What are the key properties of 2-(1,3-benzodioxol-5-yl)-3-bromoimidazo[1,2-a]pyrimidine?
2-(1,3-benzodioxol-5-yl)-3-bromoimidazo[1,2-a]pyrimidine has a molecular weight of 318.13 g/mol, XLogP of 2.89, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-benzodioxol-5-yl)-3-bromoimidazo[1,2-a]pyrimidine is sourced from PubChem (CID 5170670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).