About 2-azaniumylethylazanium dichloride
2-azaniumylethylazanium dichloride (PubChem CID 517069) has the molecular formula C2H10Cl2N2
and a molecular weight of 133.02 g/mol. Its IUPAC name is 2-azaniumylethylazanium dichloride.
Molecular Properties
| Compound Name | 2-azaniumylethylazanium dichloride |
| PubChem CID | 517069 |
| Molecular Formula | C2H10Cl2N2 |
| Molecular Weight | 133.02 g/mol |
| Exact Mass | 132.02 |
| IUPAC Name | 2-azaniumylethylazanium dichloride |
| SMILES | [Cl-].[Cl-].[NH3+]CC[NH3+] |
| InChI | InChI=1S/C2H8N2.2ClH/c3-1-2-4;;/h1-4H2;2*1H |
| InChIKey | OHHBFEVZJLBKEH-UHFFFAOYSA-N |
| XLogP | -8.52 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.02 |
| LogP ≤ 5 | -8.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-azaniumylethylazanium dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-azaniumylethylazanium dichloride?
The IUPAC name of 2-azaniumylethylazanium dichloride (CID 517069) is 2-azaniumylethylazanium dichloride.
What is the SMILES notation for 2-azaniumylethylazanium dichloride?
The canonical SMILES for 2-azaniumylethylazanium dichloride is [Cl-].[Cl-].[NH3+]CC[NH3+].
What is the InChIKey of 2-azaniumylethylazanium dichloride?
The InChIKey is OHHBFEVZJLBKEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H8N2.2ClH/c3-1-2-4;;/h1-4H2;2*1H.
What are the key properties of 2-azaniumylethylazanium dichloride?
2-azaniumylethylazanium dichloride has a molecular weight of 133.02 g/mol, XLogP of -8.52, 1 rotatable bonds, 2 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-azaniumylethylazanium dichloride is sourced from PubChem (CID 517069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).