C26H22N2O5S2 — CID 51707198
(1S,2R,9R,10S,11R,12S,16R)-9-(4-hydroxyphenyl)-14-(4-methoxyphenyl)-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione (PubChem CID 51707198) has the molecular formula C26H22N2O5S2 and a molecular weight of 506.61 g/mol. Its IUPAC name is (1S,2R,9R,10S,11R,12S,16R)-9-(4-hydroxyphenyl)-14-(4-methoxyphenyl)-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione.
| Compound Name | (1S,2R,9R,10S,11R,12S,16R)-9-(4-hydroxyphenyl)-14-(4-methoxyphenyl)-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione |
|---|---|
| PubChem CID | 51707198 |
| Molecular Formula | C26H22N2O5S2 |
| Molecular Weight | 506.61 g/mol |
| Exact Mass | 506.10 |
| IUPAC Name | (1S,2R,9R,10S,11R,12S,16R)-9-(4-hydroxyphenyl)-14-(4-methoxyphenyl)-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione |
| SMILES | COc1ccc(N2C(=O)[C@H]3[C@@H]4C[C@H]([C@@H]3C2=O)[C@H]2[C@H](c3ccc(O)cc3)c3sc(=O)[nH]c3S[C@H]42)cc1 |
| InChI | InChI=1S/C26H22N2O5S2/c1-33-14-8-4-12(5-9-14)28-24(30)19-15-10-16(20(19)25(28)31)21-18(15)17(11-2-6-13(29)7-3-11)22-23(34-21)27-26(32)35-22/h2-9,15-21,29H,10H2,1H3,(H,27,32)/t15-,16-,17-,18-,19-,20-,21+/m0/s1 |
| InChIKey | HUWXDLTXHKPPLB-NUNROCCHSA-N |
| XLogP | 3.83 |
| TPSA | 99.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.61 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|