C21H24BrNO6 — CID 51708653
bis(prop-2-enyl) (1R,2S,3S,4R,6E)-2-(4-bromophenyl)-4-hydroxy-6-hydroxyimino-4-methylcyclohexane-1,3-dicarboxylate (PubChem CID 51708653) has the molecular formula C21H24BrNO6 and a molecular weight of 466.33 g/mol. Its IUPAC name is bis(prop-2-enyl) (1R,2S,3S,4R,6E)-2-(4-bromophenyl)-4-hydroxy-6-hydroxyimino-4-methylcyclohexane-1,3-dicarboxylate.
| Compound Name | bis(prop-2-enyl) (1R,2S,3S,4R,6E)-2-(4-bromophenyl)-4-hydroxy-6-hydroxyimino-4-methylcyclohexane-1,3-dicarboxylate |
|---|---|
| PubChem CID | 51708653 |
| Molecular Formula | C21H24BrNO6 |
| Molecular Weight | 466.33 g/mol |
| Exact Mass | 465.08 |
| IUPAC Name | bis(prop-2-enyl) (1R,2S,3S,4R,6E)-2-(4-bromophenyl)-4-hydroxy-6-hydroxyimino-4-methylcyclohexane-1,3-dicarboxylate |
| SMILES | C=CCOC(=O)[C@H]1/C(=N/O)C[C@@](C)(O)[C@@H](C(=O)OCC=C)[C@H]1c1ccc(Br)cc1 |
| InChI | InChI=1S/C21H24BrNO6/c1-4-10-28-19(24)17-15(23-27)12-21(3,26)18(20(25)29-11-5-2)16(17)13-6-8-14(22)9-7-13/h4-9,16-18,26-27H,1-2,10-12H2,3H3/b23-15+/t16-,17-,18+,21+/m0/s1 |
| InChIKey | QWGGBHGFMADIOT-LIGYRPGISA-N |
| XLogP | 3.21 |
| TPSA | 105.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.33 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|