C19H20N2O3 — CID 51709035
1-[(3R,3aR,5R,7E)-3-(furan-2-yl)-7-(furan-2-ylmethylidene)-5-methyl-3a,4,5,6-tetrahydro-3H-indazol-2-yl]ethanone (PubChem CID 51709035) has the molecular formula C19H20N2O3 and a molecular weight of 324.38 g/mol. Its IUPAC name is 1-[(3R,3aR,5R,7E)-3-(furan-2-yl)-7-(furan-2-ylmethylidene)-5-methyl-3a,4,5,6-tetrahydro-3H-indazol-2-yl]ethanone.
| Compound Name | 1-[(3R,3aR,5R,7E)-3-(furan-2-yl)-7-(furan-2-ylmethylidene)-5-methyl-3a,4,5,6-tetrahydro-3H-indazol-2-yl]ethanone |
|---|---|
| PubChem CID | 51709035 |
| Molecular Formula | C19H20N2O3 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | 1-[(3R,3aR,5R,7E)-3-(furan-2-yl)-7-(furan-2-ylmethylidene)-5-methyl-3a,4,5,6-tetrahydro-3H-indazol-2-yl]ethanone |
| SMILES | CC(=O)N1N=C2/C(=C/c3ccco3)C[C@H](C)C[C@@H]2[C@@H]1c1ccco1 |
| InChI | InChI=1S/C19H20N2O3/c1-12-9-14(11-15-5-3-7-23-15)18-16(10-12)19(17-6-4-8-24-17)21(20-18)13(2)22/h3-8,11-12,16,19H,9-10H2,1-2H3/b14-11+/t12-,16-,19+/m0/s1 |
| InChIKey | XCUSOXGYBWDEPN-HNMYEQAXSA-N |
| XLogP | 4.26 |
| TPSA | 58.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |