About 5-cyano-2-ethoxybenzoic acid
5-cyano-2-ethoxybenzoic acid (PubChem CID 51712745) has the molecular formula C10H9NO3
and a molecular weight of 191.19 g/mol. Its IUPAC name is 5-cyano-2-ethoxybenzoic acid.
Molecular Properties
| Compound Name | 5-cyano-2-ethoxybenzoic acid |
| PubChem CID | 51712745 |
| Molecular Formula | C10H9NO3 |
| Molecular Weight | 191.19 g/mol |
| Exact Mass | 191.06 |
| IUPAC Name | 5-cyano-2-ethoxybenzoic acid |
| SMILES | CCOc1ccc(C#N)cc1C(=O)O |
| InChI | InChI=1S/C10H9NO3/c1-2-14-9-4-3-7(6-11)5-8(9)10(12)13/h3-5H,2H2,1H3,(H,12,13) |
| InChIKey | BCVHINXJPIDGNJ-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.19 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-cyano-2-ethoxybenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyano-2-ethoxybenzoic acid?
The IUPAC name of 5-cyano-2-ethoxybenzoic acid (CID 51712745) is 5-cyano-2-ethoxybenzoic acid.
What is the SMILES notation for 5-cyano-2-ethoxybenzoic acid?
The canonical SMILES for 5-cyano-2-ethoxybenzoic acid is CCOc1ccc(C#N)cc1C(=O)O.
What is the InChIKey of 5-cyano-2-ethoxybenzoic acid?
The InChIKey is BCVHINXJPIDGNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NO3/c1-2-14-9-4-3-7(6-11)5-8(9)10(12)13/h3-5H,2H2,1H3,(H,12,13).
What are the key properties of 5-cyano-2-ethoxybenzoic acid?
5-cyano-2-ethoxybenzoic acid has a molecular weight of 191.19 g/mol, XLogP of 1.66, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyano-2-ethoxybenzoic acid is sourced from PubChem (CID 51712745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).