C26H25Cl2N3O3 — CID 5171359
4-butyl-N-[[4-[2-(3,4-dichloroanilino)-2-oxoethoxy]phenyl]methylideneamino]benzamide (PubChem CID 5171359) has the molecular formula C26H25Cl2N3O3 and a molecular weight of 498.41 g/mol. Its IUPAC name is 4-butyl-N-[[4-[2-(3,4-dichloroanilino)-2-oxoethoxy]phenyl]methylideneamino]benzamide.
| Compound Name | 4-butyl-N-[[4-[2-(3,4-dichloroanilino)-2-oxoethoxy]phenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 5171359 |
| Molecular Formula | C26H25Cl2N3O3 |
| Molecular Weight | 498.41 g/mol |
| Exact Mass | 497.13 |
| IUPAC Name | 4-butyl-N-[[4-[2-(3,4-dichloroanilino)-2-oxoethoxy]phenyl]methylideneamino]benzamide |
| SMILES | CCCCc1ccc(C(=O)NN=Cc2ccc(OCC(=O)Nc3ccc(Cl)c(Cl)c3)cc2)cc1 |
| InChI | InChI=1S/C26H25Cl2N3O3/c1-2-3-4-18-5-9-20(10-6-18)26(33)31-29-16-19-7-12-22(13-8-19)34-17-25(32)30-21-11-14-23(27)24(28)15-21/h5-16H,2-4,17H2,1H3,(H,30,32)(H,31,33) |
| InChIKey | BXKZDUUCPLYYIL-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.41 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|