C28H33N2O6S+ — CID 51715446
6-[2-[4-(N-acetylanilino)buta-1,3-dienyl]-3,3-dimethyl-5-sulfoindol-1-ium-1-yl]hexanoic acid (PubChem CID 51715446) has the molecular formula C28H33N2O6S+ and a molecular weight of 525.65 g/mol. Its IUPAC name is 6-[2-[4-(N-acetylanilino)buta-1,3-dienyl]-3,3-dimethyl-5-sulfoindol-1-ium-1-yl]hexanoic acid.
| Compound Name | 6-[2-[4-(N-acetylanilino)buta-1,3-dienyl]-3,3-dimethyl-5-sulfoindol-1-ium-1-yl]hexanoic acid |
|---|---|
| PubChem CID | 51715446 |
| Molecular Formula | C28H33N2O6S+ |
| Molecular Weight | 525.65 g/mol |
| Exact Mass | 525.21 |
| IUPAC Name | 6-[2-[4-(N-acetylanilino)buta-1,3-dienyl]-3,3-dimethyl-5-sulfoindol-1-ium-1-yl]hexanoic acid |
| SMILES | CC(=O)N(C=CC=CC1=[N+](CCCCCC(=O)O)c2ccc(S(=O)(=O)O)cc2C1(C)C)c1ccccc1 |
| InChI | InChI=1S/C28H32N2O6S/c1-21(31)29(22-12-6-4-7-13-22)18-11-9-14-26-28(2,3)24-20-23(37(34,35)36)16-17-25(24)30(26)19-10-5-8-15-27(32)33/h4,6-7,9,11-14,16-18,20H,5,8,10,15,19H2,1-3H3,(H-,32,33,34,35,36)/p+1 |
| InChIKey | LXCWKZCJNWGDFP-UHFFFAOYSA-O |
| XLogP | 5.08 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.65 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|