About sodium 1-chloroethanesulfonate
sodium 1-chloroethanesulfonate (PubChem CID 517178) has the molecular formula C2H4ClNaO3S
and a molecular weight of 166.56 g/mol. Its IUPAC name is sodium 1-chloroethanesulfonate.
Molecular Properties
| Compound Name | sodium 1-chloroethanesulfonate |
| PubChem CID | 517178 |
| Molecular Formula | C2H4ClNaO3S |
| Molecular Weight | 166.56 g/mol |
| Exact Mass | 165.95 |
| IUPAC Name | sodium 1-chloroethanesulfonate |
| SMILES | CC(Cl)S(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C2H5ClO3S.Na/c1-2(3)7(4,5)6;/h2H,1H3,(H,4,5,6);/q;+1/p-1 |
| InChIKey | AKTHLFYZKHPYBY-UHFFFAOYSA-M |
| XLogP | -2.88 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.56 |
| LogP ≤ 5 | -2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sodium 1-chloroethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 1-chloroethanesulfonate?
The IUPAC name of sodium 1-chloroethanesulfonate (CID 517178) is sodium 1-chloroethanesulfonate.
What is the SMILES notation for sodium 1-chloroethanesulfonate?
The canonical SMILES for sodium 1-chloroethanesulfonate is CC(Cl)S(=O)(=O)[O-].[Na+].
What is the InChIKey of sodium 1-chloroethanesulfonate?
The InChIKey is AKTHLFYZKHPYBY-UHFFFAOYSA-M. The full InChI is InChI=1S/C2H5ClO3S.Na/c1-2(3)7(4,5)6;/h2H,1H3,(H,4,5,6);/q;+1/p-1.
What are the key properties of sodium 1-chloroethanesulfonate?
sodium 1-chloroethanesulfonate has a molecular weight of 166.56 g/mol, XLogP of -2.88, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 1-chloroethanesulfonate is sourced from PubChem (CID 517178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).