C17H20ClN3 — CID 517204
3-N,3-N,6-N,6-N-tetramethylacridine-3,6-diamine;hydrochloride (PubChem CID 517204) has the molecular formula C17H20ClN3 and a molecular weight of 301.82 g/mol. Its IUPAC name is 3-N,3-N,6-N,6-N-tetramethylacridine-3,6-diamine;hydrochloride.
| Compound Name | 3-N,3-N,6-N,6-N-tetramethylacridine-3,6-diamine;hydrochloride |
|---|---|
| PubChem CID | 517204 |
| Molecular Formula | C17H20ClN3 |
| Molecular Weight | 301.82 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | 3-N,3-N,6-N,6-N-tetramethylacridine-3,6-diamine;hydrochloride |
| SMILES | CN(C)c1ccc2cc3ccc(N(C)C)cc3nc2c1.Cl |
| InChI | InChI=1S/C17H19N3.ClH/c1-19(2)14-7-5-12-9-13-6-8-15(20(3)4)11-17(13)18-16(12)10-14;/h5-11H,1-4H3;1H |
| InChIKey | VSTHNGLPHBTRMB-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.82 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|