C23H26N4O4 — CID 51721136
3-[(S)-carboxy-[4-(2-pyridin-4-ylethyl)piperazin-1-yl]methyl]-1-methylindole-2-carboxylic acid (PubChem CID 51721136) has the molecular formula C23H26N4O4 and a molecular weight of 422.49 g/mol. Its IUPAC name is 3-[(S)-carboxy-[4-(2-pyridin-4-ylethyl)piperazin-1-yl]methyl]-1-methylindole-2-carboxylic acid.
| Compound Name | 3-[(S)-carboxy-[4-(2-pyridin-4-ylethyl)piperazin-1-yl]methyl]-1-methylindole-2-carboxylic acid |
|---|---|
| PubChem CID | 51721136 |
| Molecular Formula | C23H26N4O4 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | 3-[(S)-carboxy-[4-(2-pyridin-4-ylethyl)piperazin-1-yl]methyl]-1-methylindole-2-carboxylic acid |
| SMILES | Cn1c(C(=O)O)c([C@@H](C(=O)O)N2CCN(CCc3ccncc3)CC2)c2ccccc21 |
| InChI | InChI=1S/C23H26N4O4/c1-25-18-5-3-2-4-17(18)19(20(25)22(28)29)21(23(30)31)27-14-12-26(13-15-27)11-8-16-6-9-24-10-7-16/h2-7,9-10,21H,8,11-15H2,1H3,(H,28,29)(H,30,31)/t21-/m0/s1 |
| InChIKey | GBBLYCZLVRJNRJ-NRFANRHFSA-N |
| XLogP | 2.26 |
| TPSA | 98.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|