C28H28N4O3S — CID 5172120
2-[3-(4-ethoxyphenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-[(4-propan-2-ylphenyl)methylideneamino]acetamide (PubChem CID 5172120) has the molecular formula C28H28N4O3S and a molecular weight of 500.62 g/mol. Its IUPAC name is 2-[3-(4-ethoxyphenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-[(4-propan-2-ylphenyl)methylideneamino]acetamide.
| Compound Name | 2-[3-(4-ethoxyphenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-[(4-propan-2-ylphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 5172120 |
| Molecular Formula | C28H28N4O3S |
| Molecular Weight | 500.62 g/mol |
| Exact Mass | 500.19 |
| IUPAC Name | 2-[3-(4-ethoxyphenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-[(4-propan-2-ylphenyl)methylideneamino]acetamide |
| SMILES | CCOc1ccc(-n2c(SCC(=O)NN=Cc3ccc(C(C)C)cc3)nc3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C28H28N4O3S/c1-4-35-23-15-13-22(14-16-23)32-27(34)24-7-5-6-8-25(24)30-28(32)36-18-26(33)31-29-17-20-9-11-21(12-10-20)19(2)3/h5-17,19H,4,18H2,1-3H3,(H,31,33) |
| InChIKey | DBICQEAJKLYVIJ-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 85.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.62 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|