About copper;bis(1-hydroxypyridine-2-thione)
copper;bis(1-hydroxypyridine-2-thione) (PubChem CID 517214) has the molecular formula C10H10CuN2O2S2
and a molecular weight of 317.88 g/mol. Its IUPAC name is copper;bis(1-hydroxypyridine-2-thione).
Molecular Properties
| Compound Name | copper;bis(1-hydroxypyridine-2-thione) |
| PubChem CID | 517214 |
| Molecular Formula | C10H10CuN2O2S2 |
| Molecular Weight | 317.88 g/mol |
| Exact Mass | 316.95 |
| IUPAC Name | copper;bis(1-hydroxypyridine-2-thione) |
| SMILES | On1ccccc1=S.On1ccccc1=S.[Cu] |
| InChI | InChI=1S/2C5H5NOS.Cu/c2*7-6-4-2-1-3-5(6)8;/h2*1-4,7H; |
| InChIKey | QHNCWVQDOPICKC-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 50.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.88 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze copper;bis(1-hydroxypyridine-2-thione) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper;bis(1-hydroxypyridine-2-thione)?
The IUPAC name of copper;bis(1-hydroxypyridine-2-thione) (CID 517214) is copper;bis(1-hydroxypyridine-2-thione).
What is the SMILES notation for copper;bis(1-hydroxypyridine-2-thione)?
The canonical SMILES for copper;bis(1-hydroxypyridine-2-thione) is On1ccccc1=S.On1ccccc1=S.[Cu].
What is the InChIKey of copper;bis(1-hydroxypyridine-2-thione)?
The InChIKey is QHNCWVQDOPICKC-UHFFFAOYSA-N. The full InChI is InChI=1S/2C5H5NOS.Cu/c2*7-6-4-2-1-3-5(6)8;/h2*1-4,7H;.
What are the key properties of copper;bis(1-hydroxypyridine-2-thione)?
copper;bis(1-hydroxypyridine-2-thione) has a molecular weight of 317.88 g/mol, XLogP of 2.91, 0 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for copper;bis(1-hydroxypyridine-2-thione) is sourced from PubChem (CID 517214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).