C23H17ClN2O4S — CID 51721416
(7S)-3-(2-chlorophenyl)-1',7'-dimethyl-2',5-dioxospiro[4,6-dihydrothieno[3,2-b]pyridine-7,3'-indole]-2-carboxylic acid (PubChem CID 51721416) has the molecular formula C23H17ClN2O4S and a molecular weight of 452.92 g/mol. Its IUPAC name is (7S)-3-(2-chlorophenyl)-1',7'-dimethyl-2',5-dioxospiro[4,6-dihydrothieno[3,2-b]pyridine-7,3'-indole]-2-carboxylic acid.
| Compound Name | (7S)-3-(2-chlorophenyl)-1',7'-dimethyl-2',5-dioxospiro[4,6-dihydrothieno[3,2-b]pyridine-7,3'-indole]-2-carboxylic acid |
|---|---|
| PubChem CID | 51721416 |
| Molecular Formula | C23H17ClN2O4S |
| Molecular Weight | 452.92 g/mol |
| Exact Mass | 452.06 |
| IUPAC Name | (7S)-3-(2-chlorophenyl)-1',7'-dimethyl-2',5-dioxospiro[4,6-dihydrothieno[3,2-b]pyridine-7,3'-indole]-2-carboxylic acid |
| SMILES | Cc1cccc2c1N(C)C(=O)[C@]21CC(=O)Nc2c1sc(C(=O)O)c2-c1ccccc1Cl |
| InChI | InChI=1S/C23H17ClN2O4S/c1-11-6-5-8-13-18(11)26(2)22(30)23(13)10-15(27)25-17-16(12-7-3-4-9-14(12)24)19(21(28)29)31-20(17)23/h3-9H,10H2,1-2H3,(H,25,27)(H,28,29)/t23-/m1/s1 |
| InChIKey | CPZMTYGXMWFRGJ-HSZRJFAPSA-N |
| XLogP | 4.68 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.92 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |