C19H23NO2S — CID 5172204
2-methyl-1-(2,3,5,6-tetramethylphenyl)sulfonyl-2,3-dihydroindole (PubChem CID 5172204) has the molecular formula C19H23NO2S and a molecular weight of 329.47 g/mol. Its IUPAC name is 2-methyl-1-(2,3,5,6-tetramethylphenyl)sulfonyl-2,3-dihydroindole.
| Compound Name | 2-methyl-1-(2,3,5,6-tetramethylphenyl)sulfonyl-2,3-dihydroindole |
|---|---|
| PubChem CID | 5172204 |
| Molecular Formula | C19H23NO2S |
| Molecular Weight | 329.47 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | 2-methyl-1-(2,3,5,6-tetramethylphenyl)sulfonyl-2,3-dihydroindole |
| SMILES | Cc1cc(C)c(C)c(S(=O)(=O)N2c3ccccc3CC2C)c1C |
| InChI | InChI=1S/C19H23NO2S/c1-12-10-13(2)16(5)19(15(12)4)23(21,22)20-14(3)11-17-8-6-7-9-18(17)20/h6-10,14H,11H2,1-5H3 |
| InChIKey | NGNZLCWCBMNTDR-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.47 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |