C18H19N3OS — CID 51725949
1-[(3S)-3-(1H-benzimidazol-2-yl)piperidin-1-yl]-2-thiophen-2-ylethanone (PubChem CID 51725949) has the molecular formula C18H19N3OS and a molecular weight of 325.44 g/mol. Its IUPAC name is 1-[(3S)-3-(1H-benzimidazol-2-yl)piperidin-1-yl]-2-thiophen-2-ylethanone.
| Compound Name | 1-[(3S)-3-(1H-benzimidazol-2-yl)piperidin-1-yl]-2-thiophen-2-ylethanone |
|---|---|
| PubChem CID | 51725949 |
| Molecular Formula | C18H19N3OS |
| Molecular Weight | 325.44 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | 1-[(3S)-3-(1H-benzimidazol-2-yl)piperidin-1-yl]-2-thiophen-2-ylethanone |
| SMILES | O=C(Cc1cccs1)N1CCC[C@H](c2nc3ccccc3[nH]2)C1 |
| InChI | InChI=1S/C18H19N3OS/c22-17(11-14-6-4-10-23-14)21-9-3-5-13(12-21)18-19-15-7-1-2-8-16(15)20-18/h1-2,4,6-8,10,13H,3,5,9,11-12H2,(H,19,20)/t13-/m0/s1 |
| InChIKey | PAVXRZNZHRIKMX-ZDUSSCGKSA-N |
| XLogP | 3.57 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.44 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |