C12H12Cl2N2O3S — CID 51726005
(5R)-3-[2-(2,5-dichlorothiophen-3-yl)-2-oxoethyl]-5-propan-2-ylimidazolidine-2,4-dione (PubChem CID 51726005) has the molecular formula C12H12Cl2N2O3S and a molecular weight of 335.21 g/mol. Its IUPAC name is (5R)-3-[2-(2,5-dichlorothiophen-3-yl)-2-oxoethyl]-5-propan-2-ylimidazolidine-2,4-dione.
| Compound Name | (5R)-3-[2-(2,5-dichlorothiophen-3-yl)-2-oxoethyl]-5-propan-2-ylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 51726005 |
| Molecular Formula | C12H12Cl2N2O3S |
| Molecular Weight | 335.21 g/mol |
| Exact Mass | 333.99 |
| IUPAC Name | (5R)-3-[2-(2,5-dichlorothiophen-3-yl)-2-oxoethyl]-5-propan-2-ylimidazolidine-2,4-dione |
| SMILES | CC(C)[C@H]1NC(=O)N(CC(=O)c2cc(Cl)sc2Cl)C1=O |
| InChI | InChI=1S/C12H12Cl2N2O3S/c1-5(2)9-11(18)16(12(19)15-9)4-7(17)6-3-8(13)20-10(6)14/h3,5,9H,4H2,1-2H3,(H,15,19)/t9-/m1/s1 |
| InChIKey | ZKBCLZLOBNUTTI-SECBINFHSA-N |
| XLogP | 2.81 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.21 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|