C13H20N2O4S — CID 51726077
5-(cyclopropylsulfamoyl)-N-[(2R)-3-methylbutan-2-yl]furan-2-carboxamide (PubChem CID 51726077) has the molecular formula C13H20N2O4S and a molecular weight of 300.38 g/mol. Its IUPAC name is 5-(cyclopropylsulfamoyl)-N-[(2R)-3-methylbutan-2-yl]furan-2-carboxamide.
| Compound Name | 5-(cyclopropylsulfamoyl)-N-[(2R)-3-methylbutan-2-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 51726077 |
| Molecular Formula | C13H20N2O4S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | 5-(cyclopropylsulfamoyl)-N-[(2R)-3-methylbutan-2-yl]furan-2-carboxamide |
| SMILES | CC(C)[C@@H](C)NC(=O)c1ccc(S(=O)(=O)NC2CC2)o1 |
| InChI | InChI=1S/C13H20N2O4S/c1-8(2)9(3)14-13(16)11-6-7-12(19-11)20(17,18)15-10-4-5-10/h6-10,15H,4-5H2,1-3H3,(H,14,16)/t9-/m1/s1 |
| InChIKey | MZVWAMQGAPKQNH-SECBINFHSA-N |
| XLogP | 1.49 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |