C17H21ClN2O2 — CID 51726227
(3R)-N-[(2S)-1-(3-chlorophenyl)propan-2-yl]-1-cyclopropyl-5-oxopyrrolidine-3-carboxamide (PubChem CID 51726227) has the molecular formula C17H21ClN2O2 and a molecular weight of 320.82 g/mol. Its IUPAC name is (3R)-N-[(2S)-1-(3-chlorophenyl)propan-2-yl]-1-cyclopropyl-5-oxopyrrolidine-3-carboxamide.
| Compound Name | (3R)-N-[(2S)-1-(3-chlorophenyl)propan-2-yl]-1-cyclopropyl-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 51726227 |
| Molecular Formula | C17H21ClN2O2 |
| Molecular Weight | 320.82 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | (3R)-N-[(2S)-1-(3-chlorophenyl)propan-2-yl]-1-cyclopropyl-5-oxopyrrolidine-3-carboxamide |
| SMILES | C[C@@H](Cc1cccc(Cl)c1)NC(=O)[C@@H]1CC(=O)N(C2CC2)C1 |
| InChI | InChI=1S/C17H21ClN2O2/c1-11(7-12-3-2-4-14(18)8-12)19-17(22)13-9-16(21)20(10-13)15-5-6-15/h2-4,8,11,13,15H,5-7,9-10H2,1H3,(H,19,22)/t11-,13+/m0/s1 |
| InChIKey | JPXSNZZNZLMIHZ-WCQYABFASA-N |
| XLogP | 2.40 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.82 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |