C24H26N4OS — CID 51726753
2-[(4-propan-2-yl-1,2,4-triazol-3-yl)sulfanyl]-N-[[(15S)-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl]methyl]acetamide (PubChem CID 51726753) has the molecular formula C24H26N4OS and a molecular weight of 418.57 g/mol. Its IUPAC name is 2-[(4-propan-2-yl-1,2,4-triazol-3-yl)sulfanyl]-N-[[(15S)-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl]methyl]acetamide.
| Compound Name | 2-[(4-propan-2-yl-1,2,4-triazol-3-yl)sulfanyl]-N-[[(15S)-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl]methyl]acetamide |
|---|---|
| PubChem CID | 51726753 |
| Molecular Formula | C24H26N4OS |
| Molecular Weight | 418.57 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | 2-[(4-propan-2-yl-1,2,4-triazol-3-yl)sulfanyl]-N-[[(15S)-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl]methyl]acetamide |
| SMILES | CC(C)n1cnnc1SCC(=O)NC[C@H]1CC2c3ccccc3C1c1ccccc12 |
| InChI | InChI=1S/C24H26N4OS/c1-15(2)28-14-26-27-24(28)30-13-22(29)25-12-16-11-21-17-7-3-5-9-19(17)23(16)20-10-6-4-8-18(20)21/h3-10,14-16,21,23H,11-13H2,1-2H3,(H,25,29)/t16-,21?,23?/m1/s1 |
| InChIKey | RELVRVRAIDOHNI-SGZOKEPCSA-N |
| XLogP | 4.36 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.57 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |