C18H24N4O2 — CID 51729245
N-[(1R,2R,3R)-2,3-dimethylcyclohexyl]-3-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)propanamide (PubChem CID 51729245) has the molecular formula C18H24N4O2 and a molecular weight of 328.42 g/mol. Its IUPAC name is N-[(1R,2R,3R)-2,3-dimethylcyclohexyl]-3-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)propanamide.
| Compound Name | N-[(1R,2R,3R)-2,3-dimethylcyclohexyl]-3-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)propanamide |
|---|---|
| PubChem CID | 51729245 |
| Molecular Formula | C18H24N4O2 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | N-[(1R,2R,3R)-2,3-dimethylcyclohexyl]-3-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)propanamide |
| SMILES | C[C@@H]1[C@H](C)CCC[C@H]1NC(=O)CCc1nc(-c2cccnc2)no1 |
| InChI | InChI=1S/C18H24N4O2/c1-12-5-3-7-15(13(12)2)20-16(23)8-9-17-21-18(22-24-17)14-6-4-10-19-11-14/h4,6,10-13,15H,3,5,7-9H2,1-2H3,(H,20,23)/t12-,13-,15-/m1/s1 |
| InChIKey | MTYDYPLOPMAUCE-UMVBOHGHSA-N |
| XLogP | 3.01 |
| TPSA | 80.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |