About 3-[N-(4,5-dihydro-1H-imidazol-1-ium-2-ylmethyl)-4-methylanilino]phenol;methanesulfonate
3-[N-(4,5-dihydro-1H-imidazol-1-ium-2-ylmethyl)-4-methylanilino]phenol;methanesulfonate (PubChem CID 517293) has the molecular formula C18H23N3O4S
and a molecular weight of 377.47 g/mol. Its IUPAC name is 3-[N-(4,5-dihydro-1H-imidazol-1-ium-2-ylmethyl)-4-methylanilino]phenol;methanesulfonate.
Molecular Properties
| Compound Name | 3-[N-(4,5-dihydro-1H-imidazol-1-ium-2-ylmethyl)-4-methylanilino]phenol;methanesulfonate |
| PubChem CID | 517293 |
| Molecular Formula | C18H23N3O4S |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | 3-[N-(4,5-dihydro-1H-imidazol-1-ium-2-ylmethyl)-4-methylanilino]phenol;methanesulfonate |
| SMILES | CS(=O)(=O)[O-].Cc1ccc(N(CC2=NCC[NH2+]2)c2cccc(O)c2)cc1 |
| InChI | InChI=1S/C17H19N3O.CH4O3S/c1-13-5-7-14(8-6-13)20(12-17-18-9-10-19-17)15-3-2-4-16(21)11-15;1-5(2,3)4/h2-8,11,21H,9-10,12H2,1H3,(H,18,19);1H3,(H,2,3,4) |
| InChIKey | OGIYDFVHFQEFKQ-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 109.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 3-[N-(4,5-dihydro-1H-imidazol-1-ium-2-ylmethyl)-4-methylanilino]phenol;methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[N-(4,5-dihydro-1H-imidazol-1-ium-2-ylmethyl)-4-methylanilino]phenol;methanesulfonate?
The IUPAC name of 3-[N-(4,5-dihydro-1H-imidazol-1-ium-2-ylmethyl)-4-methylanilino]phenol;methanesulfonate (CID 517293) is 3-[N-(4,5-dihydro-1H-imidazol-1-ium-2-ylmethyl)-4-methylanilino]phenol;methanesulfonate.
What is the SMILES notation for 3-[N-(4,5-dihydro-1H-imidazol-1-ium-2-ylmethyl)-4-methylanilino]phenol;methanesulfonate?
The canonical SMILES for 3-[N-(4,5-dihydro-1H-imidazol-1-ium-2-ylmethyl)-4-methylanilino]phenol;methanesulfonate is CS(=O)(=O)[O-].Cc1ccc(N(CC2=NCC[NH2+]2)c2cccc(O)c2)cc1.
What is the InChIKey of 3-[N-(4,5-dihydro-1H-imidazol-1-ium-2-ylmethyl)-4-methylanilino]phenol;methanesulfonate?
The InChIKey is OGIYDFVHFQEFKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19N3O.CH4O3S/c1-13-5-7-14(8-6-13)20(12-17-18-9-10-19-17)15-3-2-4-16(21)11-15;1-5(2,3)4/h2-8,11,21H,9-10,12H2,1H3,(H,18,19);1H3,(H,2,3,4).
What are the key properties of 3-[N-(4,5-dihydro-1H-imidazol-1-ium-2-ylmethyl)-4-methylanilino]phenol;methanesulfonate?
3-[N-(4,5-dihydro-1H-imidazol-1-ium-2-ylmethyl)-4-methylanilino]phenol;methanesulfonate has a molecular weight of 377.47 g/mol, XLogP of 0.98, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[N-(4,5-dihydro-1H-imidazol-1-ium-2-ylmethyl)-4-methylanilino]phenol;methanesulfonate is sourced from PubChem (CID 517293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).