About 1-[3-(4-chlorophenyl)-1,2-oxazol-5-yl]-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]ethanone
1-[3-(4-chlorophenyl)-1,2-oxazol-5-yl]-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]ethanone (PubChem CID 5173035) has the molecular formula C17H10ClF3N2O2S
and a molecular weight of 398.79 g/mol. Its IUPAC name is 1-[3-(4-chlorophenyl)-1,2-oxazol-5-yl]-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]ethanone.
Molecular Properties
| Compound Name | 1-[3-(4-chlorophenyl)-1,2-oxazol-5-yl]-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]ethanone |
| PubChem CID | 5173035 |
| Molecular Formula | C17H10ClF3N2O2S |
| Molecular Weight | 398.79 g/mol |
| Exact Mass | 398.01 |
| IUPAC Name | 1-[3-(4-chlorophenyl)-1,2-oxazol-5-yl]-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]ethanone |
| SMILES | O=C(CSc1ccc(C(F)(F)F)cn1)c1cc(-c2ccc(Cl)cc2)no1 |
| InChI | InChI=1S/C17H10ClF3N2O2S/c18-12-4-1-10(2-5-12)13-7-15(25-23-13)14(24)9-26-16-6-3-11(8-22-16)17(19,20)21/h1-8H,9H2 |
| InChIKey | LQGRFJTZNMCCQC-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 398.79 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[3-(4-chlorophenyl)-1,2-oxazol-5-yl]-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(4-chlorophenyl)-1,2-oxazol-5-yl]-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]ethanone?
The IUPAC name of 1-[3-(4-chlorophenyl)-1,2-oxazol-5-yl]-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]ethanone (CID 5173035) is 1-[3-(4-chlorophenyl)-1,2-oxazol-5-yl]-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]ethanone.
What is the SMILES notation for 1-[3-(4-chlorophenyl)-1,2-oxazol-5-yl]-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]ethanone?
The canonical SMILES for 1-[3-(4-chlorophenyl)-1,2-oxazol-5-yl]-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]ethanone is O=C(CSc1ccc(C(F)(F)F)cn1)c1cc(-c2ccc(Cl)cc2)no1.
What is the InChIKey of 1-[3-(4-chlorophenyl)-1,2-oxazol-5-yl]-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]ethanone?
The InChIKey is LQGRFJTZNMCCQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H10ClF3N2O2S/c18-12-4-1-10(2-5-12)13-7-15(25-23-13)14(24)9-26-16-6-3-11(8-22-16)17(19,20)21/h1-8H,9H2.
What are the key properties of 1-[3-(4-chlorophenyl)-1,2-oxazol-5-yl]-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]ethanone?
1-[3-(4-chlorophenyl)-1,2-oxazol-5-yl]-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]ethanone has a molecular weight of 398.79 g/mol, XLogP of 5.38, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(4-chlorophenyl)-1,2-oxazol-5-yl]-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]ethanone is sourced from PubChem (CID 5173035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).