C38H44N2O6+2 — CID 517311
9,25-dimethoxy-15,15,30,30-tetramethyl-7,23-dioxa-15,30-diazoniaheptacyclo[22.6.2.23,6.18,12.118,22.027,31.016,34]hexatriaconta-3(36),4,6(35),8(34),9,11,18(33),19,21,24,26,31-dodecaene-10,21-diol (PubChem CID 517311) has the molecular formula C38H44N2O6+2 and a molecular weight of 624.78 g/mol. Its IUPAC name is 9,25-dimethoxy-15,15,30,30-tetramethyl-7,23-dioxa-15,30-diazoniaheptacyclo[22.6.2.23,6.18,12.118,22.027,31.016,34]hexatriaconta-3(36),4,6(35),8(34),9,11,18(33),19,21,24,26,31-dodecaene-10,21-diol.
| Compound Name | 9,25-dimethoxy-15,15,30,30-tetramethyl-7,23-dioxa-15,30-diazoniaheptacyclo[22.6.2.23,6.18,12.118,22.027,31.016,34]hexatriaconta-3(36),4,6(35),8(34),9,11,18(33),19,21,24,26,31-dodecaene-10,21-diol |
|---|---|
| PubChem CID | 517311 |
| Molecular Formula | C38H44N2O6+2 |
| Molecular Weight | 624.78 g/mol |
| Exact Mass | 624.32 |
| IUPAC Name | 9,25-dimethoxy-15,15,30,30-tetramethyl-7,23-dioxa-15,30-diazoniaheptacyclo[22.6.2.23,6.18,12.118,22.027,31.016,34]hexatriaconta-3(36),4,6(35),8(34),9,11,18(33),19,21,24,26,31-dodecaene-10,21-diol |
| SMILES | COc1cc2c3cc1Oc1cc(ccc1O)CC1c4c(cc(O)c(OC)c4Oc4ccc(cc4)CC3[N+](C)(C)CC2)CC[N+]1(C)C |
| InChI | InChI=1S/C38H42N2O6/c1-39(2)15-13-25-21-34(43-5)35-22-28(25)29(39)17-23-7-10-27(11-8-23)45-38-36-26(20-32(42)37(38)44-6)14-16-40(3,4)30(36)18-24-9-12-31(41)33(19-24)46-35/h7-12,19-22,29-30H,13-18H2,1-6H3/p+2 |
| InChIKey | RTIQKWHRAFFWIG-UHFFFAOYSA-P |
| XLogP | 6.85 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.78 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|