About sodium;2-methyl-1,4-dioxo-3H-naphthalene-2-sulfonate;hydrate
sodium;2-methyl-1,4-dioxo-3H-naphthalene-2-sulfonate;hydrate (PubChem CID 517318) has the molecular formula C11H11NaO6S
and a molecular weight of 294.26 g/mol. Its IUPAC name is sodium;2-methyl-1,4-dioxo-3H-naphthalene-2-sulfonate;hydrate.
Molecular Properties
| Compound Name | sodium;2-methyl-1,4-dioxo-3H-naphthalene-2-sulfonate;hydrate |
| PubChem CID | 517318 |
| Molecular Formula | C11H11NaO6S |
| Molecular Weight | 294.26 g/mol |
| Exact Mass | 294.02 |
| IUPAC Name | sodium;2-methyl-1,4-dioxo-3H-naphthalene-2-sulfonate;hydrate |
| SMILES | CC1(S(=O)(=O)[O-])CC(=O)c2ccccc2C1=O.O.[Na+] |
| InChI | InChI=1S/C11H10O5S.Na.H2O/c1-11(17(14,15)16)6-9(12)7-4-2-3-5-8(7)10(11)13;;/h2-5H,6H2,1H3,(H,14,15,16);;1H2/q;+1;/p-1 |
| InChIKey | QXTQSPTXVLMLHQ-UHFFFAOYSA-M |
| XLogP | -3.06 |
| TPSA | 122.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.26 |
| LogP ≤ 5 | -3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sodium;2-methyl-1,4-dioxo-3H-naphthalene-2-sulfonate;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;2-methyl-1,4-dioxo-3H-naphthalene-2-sulfonate;hydrate?
The IUPAC name of sodium;2-methyl-1,4-dioxo-3H-naphthalene-2-sulfonate;hydrate (CID 517318) is sodium;2-methyl-1,4-dioxo-3H-naphthalene-2-sulfonate;hydrate.
What is the SMILES notation for sodium;2-methyl-1,4-dioxo-3H-naphthalene-2-sulfonate;hydrate?
The canonical SMILES for sodium;2-methyl-1,4-dioxo-3H-naphthalene-2-sulfonate;hydrate is CC1(S(=O)(=O)[O-])CC(=O)c2ccccc2C1=O.O.[Na+].
What is the InChIKey of sodium;2-methyl-1,4-dioxo-3H-naphthalene-2-sulfonate;hydrate?
The InChIKey is QXTQSPTXVLMLHQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C11H10O5S.Na.H2O/c1-11(17(14,15)16)6-9(12)7-4-2-3-5-8(7)10(11)13;;/h2-5H,6H2,1H3,(H,14,15,16);;1H2/q;+1;/p-1.
What are the key properties of sodium;2-methyl-1,4-dioxo-3H-naphthalene-2-sulfonate;hydrate?
sodium;2-methyl-1,4-dioxo-3H-naphthalene-2-sulfonate;hydrate has a molecular weight of 294.26 g/mol, XLogP of -3.06, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;2-methyl-1,4-dioxo-3H-naphthalene-2-sulfonate;hydrate is sourced from PubChem (CID 517318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).