sodium 4-chlorobenzenesulfonate

C6H4ClNaO3S — CID 517331

IUPACsodium 4-chlorobenzenesulfonate
SMILESO=S(=O)([O-])c1ccc(Cl)cc1.[Na+]
InChIInChI=1S/C6H5ClO3S.Na/c7-5-1-3-6(4-2-5)11(8,9)10;/h1-4H,(H,8,9,10);/q;+1/p-1
InChIKeyXLKHCFJHGIAKFX-UHFFFAOYSA-M
MW214.61 g/mol
LogP-1.75
Rot. Bonds1

About sodium 4-chlorobenzenesulfonate

sodium 4-chlorobenzenesulfonate (PubChem CID 517331) has the molecular formula C6H4ClNaO3S and a molecular weight of 214.61 g/mol. Its IUPAC name is sodium 4-chlorobenzenesulfonate.

Molecular Properties

Compound Namesodium 4-chlorobenzenesulfonate
PubChem CID517331
Molecular FormulaC6H4ClNaO3S
Molecular Weight214.61 g/mol
Exact Mass213.95
IUPAC Namesodium 4-chlorobenzenesulfonate
SMILESO=S(=O)([O-])c1ccc(Cl)cc1.[Na+]
InChIInChI=1S/C6H5ClO3S.Na/c7-5-1-3-6(4-2-5)11(8,9)10;/h1-4H,(H,8,9,10);/q;+1/p-1
InChIKeyXLKHCFJHGIAKFX-UHFFFAOYSA-M
XLogP-1.75
TPSA57.20 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500214.61
LogP ≤ 5-1.75
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze sodium 4-chlorobenzenesulfonate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of sodium 4-chlorobenzenesulfonate?
The IUPAC name of sodium 4-chlorobenzenesulfonate (CID 517331) is sodium 4-chlorobenzenesulfonate.
What is the SMILES notation for sodium 4-chlorobenzenesulfonate?
The canonical SMILES for sodium 4-chlorobenzenesulfonate is O=S(=O)([O-])c1ccc(Cl)cc1.[Na+].
What is the InChIKey of sodium 4-chlorobenzenesulfonate?
The InChIKey is XLKHCFJHGIAKFX-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H5ClO3S.Na/c7-5-1-3-6(4-2-5)11(8,9)10;/h1-4H,(H,8,9,10);/q;+1/p-1.
What are the key properties of sodium 4-chlorobenzenesulfonate?
sodium 4-chlorobenzenesulfonate has a molecular weight of 214.61 g/mol, XLogP of -1.75, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 4-chlorobenzenesulfonate is sourced from PubChem (CID 517331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).