About ethanimidamide;hydron;chloride
ethanimidamide;hydron;chloride (PubChem CID 517332) has the molecular formula C2H7ClN2
and a molecular weight of 94.54 g/mol. Its IUPAC name is ethanimidamide;hydron;chloride.
Molecular Properties
| Compound Name | ethanimidamide;hydron;chloride |
| PubChem CID | 517332 |
| Molecular Formula | C2H7ClN2 |
| Molecular Weight | 94.54 g/mol |
| Exact Mass | 94.03 |
| IUPAC Name | ethanimidamide;hydron;chloride |
| SMILES | [Cl-].[H+].[H]/N=C(\C)N |
| InChI | InChI=1S/C2H6N2.ClH/c1-2(3)4;/h1H3,(H3,3,4);1H |
| InChIKey | WCQOBLXWLRDEQA-UHFFFAOYSA-N |
| XLogP | -2.94 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 94.54 |
| LogP ≤ 5 | -2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze ethanimidamide;hydron;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanimidamide;hydron;chloride?
The IUPAC name of ethanimidamide;hydron;chloride (CID 517332) is ethanimidamide;hydron;chloride.
What is the SMILES notation for ethanimidamide;hydron;chloride?
The canonical SMILES for ethanimidamide;hydron;chloride is [Cl-].[H+].[H]/N=C(\C)N.
What is the InChIKey of ethanimidamide;hydron;chloride?
The InChIKey is WCQOBLXWLRDEQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H6N2.ClH/c1-2(3)4;/h1H3,(H3,3,4);1H.
What are the key properties of ethanimidamide;hydron;chloride?
ethanimidamide;hydron;chloride has a molecular weight of 94.54 g/mol, XLogP of -2.94, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethanimidamide;hydron;chloride is sourced from PubChem (CID 517332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).