4-amino-3,5-dibromobenzenesulfonic acid

C6H5Br2NO3S — CID 5173465

IUPAC4-amino-3,5-dibromobenzenesulfonic acid
SMILESNc1c(Br)cc(S(=O)(=O)O)cc1Br
InChIInChI=1S/C6H5Br2NO3S/c7-4-1-3(13(10,11)12)2-5(8)6(4)9/h1-2H,9H2,(H,10,11,12)
InChIKeyKQQQNGNCDHGIIR-UHFFFAOYSA-N
MW330.99 g/mol
LogP2.04
Rot. Bonds1

About 4-amino-3,5-dibromobenzenesulfonic acid

4-amino-3,5-dibromobenzenesulfonic acid (PubChem CID 5173465) has the molecular formula C6H5Br2NO3S and a molecular weight of 330.99 g/mol. Its IUPAC name is 4-amino-3,5-dibromobenzenesulfonic acid.

Molecular Properties

Compound Name4-amino-3,5-dibromobenzenesulfonic acid
PubChem CID5173465
Molecular FormulaC6H5Br2NO3S
Molecular Weight330.99 g/mol
Exact Mass328.84
IUPAC Name4-amino-3,5-dibromobenzenesulfonic acid
SMILESNc1c(Br)cc(S(=O)(=O)O)cc1Br
InChIInChI=1S/C6H5Br2NO3S/c7-4-1-3(13(10,11)12)2-5(8)6(4)9/h1-2H,9H2,(H,10,11,12)
InChIKeyKQQQNGNCDHGIIR-UHFFFAOYSA-N
XLogP2.04
TPSA80.39 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500330.99
LogP ≤ 52.04
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 4-amino-3,5-dibromobenzenesulfonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-amino-3,5-dibromobenzenesulfonic acid?
The IUPAC name of 4-amino-3,5-dibromobenzenesulfonic acid (CID 5173465) is 4-amino-3,5-dibromobenzenesulfonic acid.
What is the SMILES notation for 4-amino-3,5-dibromobenzenesulfonic acid?
The canonical SMILES for 4-amino-3,5-dibromobenzenesulfonic acid is Nc1c(Br)cc(S(=O)(=O)O)cc1Br.
What is the InChIKey of 4-amino-3,5-dibromobenzenesulfonic acid?
The InChIKey is KQQQNGNCDHGIIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5Br2NO3S/c7-4-1-3(13(10,11)12)2-5(8)6(4)9/h1-2H,9H2,(H,10,11,12).
What are the key properties of 4-amino-3,5-dibromobenzenesulfonic acid?
4-amino-3,5-dibromobenzenesulfonic acid has a molecular weight of 330.99 g/mol, XLogP of 2.04, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-3,5-dibromobenzenesulfonic acid is sourced from PubChem (CID 5173465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).