About sodium;2-phenylphenolate;tetrahydrate
sodium;2-phenylphenolate;tetrahydrate (PubChem CID 517383) has the molecular formula C12H17NaO5
and a molecular weight of 264.25 g/mol. Its IUPAC name is sodium;2-phenylphenolate;tetrahydrate.
Molecular Properties
| Compound Name | sodium;2-phenylphenolate;tetrahydrate |
| PubChem CID | 517383 |
| Molecular Formula | C12H17NaO5 |
| Molecular Weight | 264.25 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | sodium;2-phenylphenolate;tetrahydrate |
| SMILES | O.O.O.O.[Na+].[O-]c1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C12H10O.Na.4H2O/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10;;;;;/h1-9,13H;;4*1H2/q;+1;;;;/p-1 |
| InChIKey | SEVSIOOUCUTMMP-UHFFFAOYSA-M |
| XLogP | -3.87 |
| TPSA | 149.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.25 |
| LogP ≤ 5 | -3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze sodium;2-phenylphenolate;tetrahydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;2-phenylphenolate;tetrahydrate?
The IUPAC name of sodium;2-phenylphenolate;tetrahydrate (CID 517383) is sodium;2-phenylphenolate;tetrahydrate.
What is the SMILES notation for sodium;2-phenylphenolate;tetrahydrate?
The canonical SMILES for sodium;2-phenylphenolate;tetrahydrate is O.O.O.O.[Na+].[O-]c1ccccc1-c1ccccc1.
What is the InChIKey of sodium;2-phenylphenolate;tetrahydrate?
The InChIKey is SEVSIOOUCUTMMP-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H10O.Na.4H2O/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10;;;;;/h1-9,13H;;4*1H2/q;+1;;;;/p-1.
What are the key properties of sodium;2-phenylphenolate;tetrahydrate?
sodium;2-phenylphenolate;tetrahydrate has a molecular weight of 264.25 g/mol, XLogP of -3.87, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;2-phenylphenolate;tetrahydrate is sourced from PubChem (CID 517383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).