C12H16N4O3 — CID 5173892
1',3'-dimethyl-7'-oxidospiro[cyclohexane-1,8'-purin-7-ium]-2',6'-dione (PubChem CID 5173892) has the molecular formula C12H16N4O3 and a molecular weight of 264.28 g/mol. Its IUPAC name is 1',3'-dimethyl-7'-oxidospiro[cyclohexane-1,8'-purin-7-ium]-2',6'-dione.
| Compound Name | 1',3'-dimethyl-7'-oxidospiro[cyclohexane-1,8'-purin-7-ium]-2',6'-dione |
|---|---|
| PubChem CID | 5173892 |
| Molecular Formula | C12H16N4O3 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | 1',3'-dimethyl-7'-oxidospiro[cyclohexane-1,8'-purin-7-ium]-2',6'-dione |
| SMILES | Cn1c(=O)c2c(n(C)c1=O)=NC1(CCCCC1)[N+]=2[O-] |
| InChI | InChI=1S/C12H16N4O3/c1-14-9-8(10(17)15(2)11(14)18)16(19)12(13-9)6-4-3-5-7-12/h3-7H2,1-2H3 |
| InChIKey | OCLBXSLANCGXPP-UHFFFAOYSA-N |
| XLogP | -1.63 |
| TPSA | 82.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|