C33H25ClFN3O7 — CID 5174007
8-(3-chloro-4-fluorophenyl)-6-(3-hydroxyphenyl)-6a-methyl-2-(3-nitrophenyl)-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 5174007) has the molecular formula C33H25ClFN3O7 and a molecular weight of 630.03 g/mol. Its IUPAC name is 8-(3-chloro-4-fluorophenyl)-6-(3-hydroxyphenyl)-6a-methyl-2-(3-nitrophenyl)-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 8-(3-chloro-4-fluorophenyl)-6-(3-hydroxyphenyl)-6a-methyl-2-(3-nitrophenyl)-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 5174007 |
| Molecular Formula | C33H25ClFN3O7 |
| Molecular Weight | 630.03 g/mol |
| Exact Mass | 629.14 |
| IUPAC Name | 8-(3-chloro-4-fluorophenyl)-6-(3-hydroxyphenyl)-6a-methyl-2-(3-nitrophenyl)-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | CC12C(=O)N(c3ccc(F)c(Cl)c3)C(=O)C1CC1C(=CCC3C(=O)N(c4cccc([N+](=O)[O-])c4)C(=O)C31)C2c1cccc(O)c1 |
| InChI | InChI=1S/C33H25ClFN3O7/c1-33-24(30(41)37(32(33)43)18-8-11-26(35)25(34)14-18)15-23-21(28(33)16-4-2-7-20(39)12-16)9-10-22-27(23)31(42)36(29(22)40)17-5-3-6-19(13-17)38(44)45/h2-9,11-14,22-24,27-28,39H,10,15H2,1H3 |
| InChIKey | XBTGDYWFTYWRTC-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 138.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.03 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|