C13H6Cl5N — CID 5174119
1-(2,6-dichlorophenyl)-N-(2,4,5-trichlorophenyl)methanimine (PubChem CID 5174119) has the molecular formula C13H6Cl5N and a molecular weight of 353.46 g/mol. Its IUPAC name is 1-(2,6-dichlorophenyl)-N-(2,4,5-trichlorophenyl)methanimine.
| Compound Name | 1-(2,6-dichlorophenyl)-N-(2,4,5-trichlorophenyl)methanimine |
|---|---|
| PubChem CID | 5174119 |
| Molecular Formula | C13H6Cl5N |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 350.89 |
| IUPAC Name | 1-(2,6-dichlorophenyl)-N-(2,4,5-trichlorophenyl)methanimine |
| SMILES | Clc1cc(Cl)c(/N=C/c2c(Cl)cccc2Cl)cc1Cl |
| InChI | InChI=1S/C13H6Cl5N/c14-8-2-1-3-9(15)7(8)6-19-13-5-11(17)10(16)4-12(13)18/h1-6H/b19-6+ |
| InChIKey | LNHAHFWUQHBKJN-KPSZGOFPSA-N |
| XLogP | 6.70 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|