About iron(2+);bis(1-methylcyclopenta-1,3-diene)
iron(2+);bis(1-methylcyclopenta-1,3-diene) (PubChem CID 517423) has the molecular formula C12H14Fe
and a molecular weight of 214.09 g/mol. Its IUPAC name is iron(2+);bis(1-methylcyclopenta-1,3-diene).
Molecular Properties
| Compound Name | iron(2+);bis(1-methylcyclopenta-1,3-diene) |
| PubChem CID | 517423 |
| Molecular Formula | C12H14Fe |
| Molecular Weight | 214.09 g/mol |
| Exact Mass | 214.04 |
| IUPAC Name | iron(2+);bis(1-methylcyclopenta-1,3-diene) |
| SMILES | Cc1ccc[cH-]1.Cc1ccc[cH-]1.[Fe+2] |
| InChI | InChI=1S/2C6H7.Fe/c2*1-6-4-2-3-5-6;/h2*2-5H,1H3;/q2*-1;+2 |
| InChIKey | YTOVAWUSMUMHIM-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.09 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze iron(2+);bis(1-methylcyclopenta-1,3-diene) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iron(2+);bis(1-methylcyclopenta-1,3-diene)?
The IUPAC name of iron(2+);bis(1-methylcyclopenta-1,3-diene) (CID 517423) is iron(2+);bis(1-methylcyclopenta-1,3-diene).
What is the SMILES notation for iron(2+);bis(1-methylcyclopenta-1,3-diene)?
The canonical SMILES for iron(2+);bis(1-methylcyclopenta-1,3-diene) is Cc1ccc[cH-]1.Cc1ccc[cH-]1.[Fe+2].
What is the InChIKey of iron(2+);bis(1-methylcyclopenta-1,3-diene)?
The InChIKey is YTOVAWUSMUMHIM-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H7.Fe/c2*1-6-4-2-3-5-6;/h2*2-5H,1H3;/q2*-1;+2.
What are the key properties of iron(2+);bis(1-methylcyclopenta-1,3-diene)?
iron(2+);bis(1-methylcyclopenta-1,3-diene) has a molecular weight of 214.09 g/mol, XLogP of 3.43, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for iron(2+);bis(1-methylcyclopenta-1,3-diene) is sourced from PubChem (CID 517423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).