About 1-[[2-hydroxy-5-methyl-2-(3-methylbutyl)hexanoyl]amino]-1,3-diphenylurea
1-[[2-hydroxy-5-methyl-2-(3-methylbutyl)hexanoyl]amino]-1,3-diphenylurea (PubChem CID 5174290) has the molecular formula C25H35N3O3
and a molecular weight of 425.57 g/mol. Its IUPAC name is 1-[[2-hydroxy-5-methyl-2-(3-methylbutyl)hexanoyl]amino]-1,3-diphenylurea.
Molecular Properties
| Compound Name | 1-[[2-hydroxy-5-methyl-2-(3-methylbutyl)hexanoyl]amino]-1,3-diphenylurea |
| PubChem CID | 5174290 |
| Molecular Formula | C25H35N3O3 |
| Molecular Weight | 425.57 g/mol |
| Exact Mass | 425.27 |
| IUPAC Name | 1-[[2-hydroxy-5-methyl-2-(3-methylbutyl)hexanoyl]amino]-1,3-diphenylurea |
| SMILES | CC(C)CCC(O)(CCC(C)C)C(=O)NN(C(=O)Nc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H35N3O3/c1-19(2)15-17-25(31,18-16-20(3)4)23(29)27-28(22-13-9-6-10-14-22)24(30)26-21-11-7-5-8-12-21/h5-14,19-20,31H,15-18H2,1-4H3,(H,26,30)(H,27,29) |
| InChIKey | BSSDTQRFYVKOLV-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 425.57 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[[2-hydroxy-5-methyl-2-(3-methylbutyl)hexanoyl]amino]-1,3-diphenylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[2-hydroxy-5-methyl-2-(3-methylbutyl)hexanoyl]amino]-1,3-diphenylurea?
The IUPAC name of 1-[[2-hydroxy-5-methyl-2-(3-methylbutyl)hexanoyl]amino]-1,3-diphenylurea (CID 5174290) is 1-[[2-hydroxy-5-methyl-2-(3-methylbutyl)hexanoyl]amino]-1,3-diphenylurea.
What is the SMILES notation for 1-[[2-hydroxy-5-methyl-2-(3-methylbutyl)hexanoyl]amino]-1,3-diphenylurea?
The canonical SMILES for 1-[[2-hydroxy-5-methyl-2-(3-methylbutyl)hexanoyl]amino]-1,3-diphenylurea is CC(C)CCC(O)(CCC(C)C)C(=O)NN(C(=O)Nc1ccccc1)c1ccccc1.
What is the InChIKey of 1-[[2-hydroxy-5-methyl-2-(3-methylbutyl)hexanoyl]amino]-1,3-diphenylurea?
The InChIKey is BSSDTQRFYVKOLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H35N3O3/c1-19(2)15-17-25(31,18-16-20(3)4)23(29)27-28(22-13-9-6-10-14-22)24(30)26-21-11-7-5-8-12-21/h5-14,19-20,31H,15-18H2,1-4H3,(H,26,30)(H,27,29).
What are the key properties of 1-[[2-hydroxy-5-methyl-2-(3-methylbutyl)hexanoyl]amino]-1,3-diphenylurea?
1-[[2-hydroxy-5-methyl-2-(3-methylbutyl)hexanoyl]amino]-1,3-diphenylurea has a molecular weight of 425.57 g/mol, XLogP of 5.36, 9 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[2-hydroxy-5-methyl-2-(3-methylbutyl)hexanoyl]amino]-1,3-diphenylurea is sourced from PubChem (CID 5174290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).