sodium 4-aminobenzoate

C7H6NNaO2 — CID 517441

IUPACsodium 4-aminobenzoate
SMILESNc1ccc(C(=O)[O-])cc1.[Na+]
InChIInChI=1S/C7H7NO2.Na/c8-6-3-1-5(2-4-6)7(9)10;/h1-4H,8H2,(H,9,10);/q;+1/p-1
InChIKeyXETSAYZRDCRPJY-UHFFFAOYSA-M
MW159.12 g/mol
LogP-3.36
Rot. Bonds1

About sodium 4-aminobenzoate

sodium 4-aminobenzoate (PubChem CID 517441) has the molecular formula C7H6NNaO2 and a molecular weight of 159.12 g/mol. Its IUPAC name is sodium 4-aminobenzoate.

Molecular Properties

Compound Namesodium 4-aminobenzoate
PubChem CID517441
Molecular FormulaC7H6NNaO2
Molecular Weight159.12 g/mol
Exact Mass159.03
IUPAC Namesodium 4-aminobenzoate
SMILESNc1ccc(C(=O)[O-])cc1.[Na+]
InChIInChI=1S/C7H7NO2.Na/c8-6-3-1-5(2-4-6)7(9)10;/h1-4H,8H2,(H,9,10);/q;+1/p-1
InChIKeyXETSAYZRDCRPJY-UHFFFAOYSA-M
XLogP-3.36
TPSA66.15 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500159.12
LogP ≤ 5-3.36
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aniline', 'substructure': 'N/A'}

Analyze sodium 4-aminobenzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of sodium 4-aminobenzoate?
The IUPAC name of sodium 4-aminobenzoate (CID 517441) is sodium 4-aminobenzoate.
What is the SMILES notation for sodium 4-aminobenzoate?
The canonical SMILES for sodium 4-aminobenzoate is Nc1ccc(C(=O)[O-])cc1.[Na+].
What is the InChIKey of sodium 4-aminobenzoate?
The InChIKey is XETSAYZRDCRPJY-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H7NO2.Na/c8-6-3-1-5(2-4-6)7(9)10;/h1-4H,8H2,(H,9,10);/q;+1/p-1.
What are the key properties of sodium 4-aminobenzoate?
sodium 4-aminobenzoate has a molecular weight of 159.12 g/mol, XLogP of -3.36, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 4-aminobenzoate is sourced from PubChem (CID 517441), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).