About 2-azaniumylbutanoate
2-azaniumylbutanoate (PubChem CID 517460) has the molecular formula C4H9NO2
and a molecular weight of 103.12 g/mol. Its IUPAC name is 2-azaniumylbutanoate.
Molecular Properties
| Compound Name | 2-azaniumylbutanoate |
| PubChem CID | 517460 |
| Molecular Formula | C4H9NO2 |
| Molecular Weight | 103.12 g/mol |
| Exact Mass | 103.06 |
| IUPAC Name | 2-azaniumylbutanoate |
| SMILES | CCC([NH3+])C(=O)[O-] |
| InChI | InChI=1S/C4H9NO2/c1-2-3(5)4(6)7/h3H,2,5H2,1H3,(H,6,7) |
| InChIKey | QWCKQJZIFLGMSD-UHFFFAOYSA-N |
| XLogP | -2.24 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 103.12 |
| LogP ≤ 5 | -2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-azaniumylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-azaniumylbutanoate?
The IUPAC name of 2-azaniumylbutanoate (CID 517460) is 2-azaniumylbutanoate.
What is the SMILES notation for 2-azaniumylbutanoate?
The canonical SMILES for 2-azaniumylbutanoate is CCC([NH3+])C(=O)[O-].
What is the InChIKey of 2-azaniumylbutanoate?
The InChIKey is QWCKQJZIFLGMSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9NO2/c1-2-3(5)4(6)7/h3H,2,5H2,1H3,(H,6,7).
What are the key properties of 2-azaniumylbutanoate?
2-azaniumylbutanoate has a molecular weight of 103.12 g/mol, XLogP of -2.24, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-azaniumylbutanoate is sourced from PubChem (CID 517460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).