2-bromo-5-sulfobenzoic acid

C7H5BrO5S — CID 5175201

IUPAC2-bromo-5-sulfobenzoic acid
SMILESO=C(O)c1cc(S(=O)(=O)O)ccc1Br
InChIInChI=1S/C7H5BrO5S/c8-6-2-1-4(14(11,12)13)3-5(6)7(9)10/h1-3H,(H,9,10)(H,11,12,13)
InChIKeyONWAGDITKNAKCC-UHFFFAOYSA-N
MW281.08 g/mol
LogP1.39
Rot. Bonds2

About 2-bromo-5-sulfobenzoic acid

2-bromo-5-sulfobenzoic acid (PubChem CID 5175201) has the molecular formula C7H5BrO5S and a molecular weight of 281.08 g/mol. Its IUPAC name is 2-bromo-5-sulfobenzoic acid.

Molecular Properties

Compound Name2-bromo-5-sulfobenzoic acid
PubChem CID5175201
Molecular FormulaC7H5BrO5S
Molecular Weight281.08 g/mol
Exact Mass279.90
IUPAC Name2-bromo-5-sulfobenzoic acid
SMILESO=C(O)c1cc(S(=O)(=O)O)ccc1Br
InChIInChI=1S/C7H5BrO5S/c8-6-2-1-4(14(11,12)13)3-5(6)7(9)10/h1-3H,(H,9,10)(H,11,12,13)
InChIKeyONWAGDITKNAKCC-UHFFFAOYSA-N
XLogP1.39
TPSA91.67 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500281.08
LogP ≤ 51.39
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 2-bromo-5-sulfobenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-bromo-5-sulfobenzoic acid?
The IUPAC name of 2-bromo-5-sulfobenzoic acid (CID 5175201) is 2-bromo-5-sulfobenzoic acid.
What is the SMILES notation for 2-bromo-5-sulfobenzoic acid?
The canonical SMILES for 2-bromo-5-sulfobenzoic acid is O=C(O)c1cc(S(=O)(=O)O)ccc1Br.
What is the InChIKey of 2-bromo-5-sulfobenzoic acid?
The InChIKey is ONWAGDITKNAKCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5BrO5S/c8-6-2-1-4(14(11,12)13)3-5(6)7(9)10/h1-3H,(H,9,10)(H,11,12,13).
What are the key properties of 2-bromo-5-sulfobenzoic acid?
2-bromo-5-sulfobenzoic acid has a molecular weight of 281.08 g/mol, XLogP of 1.39, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-5-sulfobenzoic acid is sourced from PubChem (CID 5175201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).