About 1,1-dibenzyl-3-(2,4-dichlorophenyl)urea
1,1-dibenzyl-3-(2,4-dichlorophenyl)urea (PubChem CID 5175202) has the molecular formula C21H18Cl2N2O
and a molecular weight of 385.29 g/mol. Its IUPAC name is 1,1-dibenzyl-3-(2,4-dichlorophenyl)urea.
Molecular Properties
| Compound Name | 1,1-dibenzyl-3-(2,4-dichlorophenyl)urea |
| PubChem CID | 5175202 |
| Molecular Formula | C21H18Cl2N2O |
| Molecular Weight | 385.29 g/mol |
| Exact Mass | 384.08 |
| IUPAC Name | 1,1-dibenzyl-3-(2,4-dichlorophenyl)urea |
| SMILES | O=C(Nc1ccc(Cl)cc1Cl)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C21H18Cl2N2O/c22-18-11-12-20(19(23)13-18)24-21(26)25(14-16-7-3-1-4-8-16)15-17-9-5-2-6-10-17/h1-13H,14-15H2,(H,24,26) |
| InChIKey | ITJZEPDILNRMBR-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 385.29 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,1-dibenzyl-3-(2,4-dichlorophenyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dibenzyl-3-(2,4-dichlorophenyl)urea?
The IUPAC name of 1,1-dibenzyl-3-(2,4-dichlorophenyl)urea (CID 5175202) is 1,1-dibenzyl-3-(2,4-dichlorophenyl)urea.
What is the SMILES notation for 1,1-dibenzyl-3-(2,4-dichlorophenyl)urea?
The canonical SMILES for 1,1-dibenzyl-3-(2,4-dichlorophenyl)urea is O=C(Nc1ccc(Cl)cc1Cl)N(Cc1ccccc1)Cc1ccccc1.
What is the InChIKey of 1,1-dibenzyl-3-(2,4-dichlorophenyl)urea?
The InChIKey is ITJZEPDILNRMBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18Cl2N2O/c22-18-11-12-20(19(23)13-18)24-21(26)25(14-16-7-3-1-4-8-16)15-17-9-5-2-6-10-17/h1-13H,14-15H2,(H,24,26).
What are the key properties of 1,1-dibenzyl-3-(2,4-dichlorophenyl)urea?
1,1-dibenzyl-3-(2,4-dichlorophenyl)urea has a molecular weight of 385.29 g/mol, XLogP of 6.23, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dibenzyl-3-(2,4-dichlorophenyl)urea is sourced from PubChem (CID 5175202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).